CAS 475278-66-1 is the registry number for N-(5-Fluoro-2-nitrophenyl)methanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-(5-fluoro-2-nitrophenyl)methanesulfonamide (CAS 475278-66-1) is a chemical compound with the molecular formula C7H7FN2O4S and a molecular weight of 234.21 g/mol. IUPAC name: N-(5-fluoro-2-nitrophenyl)methanesulfonamide. InChIKey: CGBXCAWTYKANIC-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O4S |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | N-(5-fluoro-2-nitrophenyl)methanesulfonamide |
| InChIKey | CGBXCAWTYKANIC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)