CAS 1556-99-6 appears in our catalog under these names: 4-Methylfluorene, >95% (HPLC), 4-Methylfluorene. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 250mg, 1000mg, 100mg, 500mg, 5000mg.
4-methyl-9H-fluorene (CAS 1556-99-6) is a chemical compound with the molecular formula C14H12 and a molecular weight of 180.24 g/mol. IUPAC name: 4-methyl-9H-fluorene. InChIKey: OPFILOLCFWFBNT-UHFFFAOYSA-N.
| Molecular formula | C14H12 |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | 4-methyl-9H-fluorene |
| InChIKey | OPFILOLCFWFBNT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)CC3=CC=CC=C32 |
Computed by PubChem (NCBI)