Products 1556315-61-7
CAS 1556315-61-7 appears in our catalog under these names: 1-Cyclobutyl-1H-pyrazole-5-carboxylic acid, 1-Cyclobutyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg, 500mg.
2-cyclobutylpyrazole-3-carboxylic acid (CAS 1556315-61-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-cyclobutylpyrazole-3-carboxylic acid. InChIKey: HJLBZKCWCUMXJV-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-cyclobutylpyrazole-3-carboxylic acid |
| InChIKey | HJLBZKCWCUMXJV-UHFFFAOYSA-N |
| SMILES | C1CC(C1)N2C(=CC=N2)C(=O)O |
Computed by PubChem (NCBI)