Products 1556776-36-3
CAS 1556776-36-3 is the registry number for 2-(2-Fluoro-4-methoxyphenyl)pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2-fluoro-4-methoxyphenyl)pyridin-3-amine (CAS 1556776-36-3) is a chemical compound with the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. IUPAC name: 2-(2-fluoro-4-methoxyphenyl)pyridin-3-amine. InChIKey: QXWBSGVEXVDBOQ-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 2-(2-fluoro-4-methoxyphenyl)pyridin-3-amine |
| InChIKey | QXWBSGVEXVDBOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=C(C=CC=N2)N)F |
Computed by PubChem (NCBI)