CAS 890626-54-7 is the registry number for 1-(4-Fluorophenyl)-3,5-dimethyl-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde (CAS 890626-54-7) is a chemical compound with the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. IUPAC name: 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde. InChIKey: AXOXHQSHPSKAID-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde |
| InChIKey | AXOXHQSHPSKAID-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)F)C)C=O |
Computed by PubChem (NCBI)