Products 1556966-10-9

CAS 1556966-10-9 is the registry number for Methyl 3-amino-2-(oxolan-3-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2-(oxolan-3-yl)propanoate (CAS 1556966-10-9) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: methyl 3-amino-2-(oxolan-3-yl)propanoate. InChIKey: NEZCVFNSFYKWBU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO3
Molecular weight173.21 g/mol
IUPAC namemethyl 3-amino-2-(oxolan-3-yl)propanoate
InChIKeyNEZCVFNSFYKWBU-UHFFFAOYSA-N
SMILESCOC(=O)C(CN)C1CCOC1

Computed by PubChem (NCBI)