Products 1557247-15-0

CAS 1557247-15-0 appears in our catalog under these names: Diethyl 1,4-dioxaspiro[4.4]nonane-8,8-dicarboxylate, 95%, Diethyl 1,4-dioxaspiro(4.4)nonane-8,8-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 1,4-dioxaspiro[4.4]nonane-8,8-dicarboxylate (CAS 1557247-15-0) is a chemical compound with the molecular formula C13H20O6 and a molecular weight of 272.29 g/mol. IUPAC name: diethyl 1,4-dioxaspiro[4.4]nonane-8,8-dicarboxylate. InChIKey: RGQRGGZVSYWTAW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20O6
Molecular weight272.29 g/mol
IUPAC namediethyl 1,4-dioxaspiro[4.4]nonane-8,8-dicarboxylate
InChIKeyRGQRGGZVSYWTAW-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCC2(C1)OCCO2)C(=O)OCC

Computed by PubChem (NCBI)