CAS 451472-23-4 is the registry number for (2R,3R)-1,4-Dioxaspiro(4.4)nonane-2,3-dicarboxylic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg.
Diethyl (2R,3R)-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate (CAS 451472-23-4) is a chemical compound with the molecular formula C13H20O6 and a molecular weight of 272.29 g/mol. IUPAC name: diethyl (2R,3R)-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate. InChIKey: PRVBXSOGYFNTSJ-NXEZZACHSA-N.
| Molecular formula | C13H20O6 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | diethyl (2R,3R)-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate |
| InChIKey | PRVBXSOGYFNTSJ-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@H]1[C@@H](OC2(O1)CCCC2)C(=O)OCC |
Computed by PubChem (NCBI)