Products 1557288-56-8
CAS 1557288-56-8 is the registry number for Rel-1-(tert-butyl) 3-ethyl (3R,5R)-5-methylpiperazine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-ethyl (3R,5R)-5-methylpiperazine-1,3-dicarboxylate (CAS 1557288-56-8) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,5R)-5-methylpiperazine-1,3-dicarboxylate. InChIKey: ZFGHVVAZVGZZLG-NXEZZACHSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,5R)-5-methylpiperazine-1,3-dicarboxylate |
| InChIKey | ZFGHVVAZVGZZLG-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@H](N1)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)