CAS 1557538-75-6 appears in our catalog under these names: 2-(5-{((1,3-thiazol-2-yl)amino)methyl}thiophen-2-yl)acetic acid, 95%, 2-(5-{((1,3-Thiazol-2-yl)amino)methyl}thiophen-2-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[5-[(1,3-thiazol-2-ylamino)methyl]thiophen-2-yl]acetic acid (CAS 1557538-75-6) is a chemical compound with the molecular formula C10H10N2O2S2 and a molecular weight of 254.3 g/mol. IUPAC name: 2-[5-[(1,3-thiazol-2-ylamino)methyl]thiophen-2-yl]acetic acid. InChIKey: RYMCEVJIXBGJQP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 2-[5-[(1,3-thiazol-2-ylamino)methyl]thiophen-2-yl]acetic acid |
| InChIKey | RYMCEVJIXBGJQP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)NCC2=CC=C(S2)CC(=O)O |
Computed by PubChem (NCBI)