CAS 174223-30-4 is the registry number for Ethyl 2'-methyl-[2,4'-bithiazole]-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate (CAS 174223-30-4) is a chemical compound with the molecular formula C10H10N2O2S2 and a molecular weight of 254.3 g/mol. IUPAC name: ethyl 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate. InChIKey: FHGMNWOUMCGLTE-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | ethyl 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | FHGMNWOUMCGLTE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CSC(=N2)C |
Computed by PubChem (NCBI)