CAS 1557624-71-1 appears in our catalog under these names: 4-Methanesulfonylcyclohexane-1-carboxylic acid, 4-Methanesulfonylcyclohexane-1-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-methylsulfonylcyclohexane-1-carboxylic acid (CAS 1557624-71-1) is a chemical compound with the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. IUPAC name: 4-methylsulfonylcyclohexane-1-carboxylic acid. InChIKey: MVQHKXUNJHGRPX-UHFFFAOYSA-N.
| Molecular formula | C8H14O4S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 4-methylsulfonylcyclohexane-1-carboxylic acid |
| InChIKey | MVQHKXUNJHGRPX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)