CAS 1803588-99-9 appears in our catalog under these names: tert-Butyl 2-(ethenesulfonyl)acetate, 95% +(stabilized with TBC), tert-Butyl 2-(ethenesulfonyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 2-ethenylsulfonylacetate (CAS 1803588-99-9) is a chemical compound with the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. IUPAC name: tert-butyl 2-ethenylsulfonylacetate. InChIKey: LUIDIEJSPJROKT-UHFFFAOYSA-N.
| Molecular formula | C8H14O4S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | tert-butyl 2-ethenylsulfonylacetate |
| InChIKey | LUIDIEJSPJROKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)C=C |
Computed by PubChem (NCBI)