Products 1558734-77-2
CAS 1558734-77-2 is the registry number for (2,3-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2,3-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 1558734-77-2) is a chemical compound with the molecular formula C12H14ClF2NO and a molecular weight of 261.69 g/mol. IUPAC name: (2,3-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: GKURTJIGSLFJOG-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO |
|---|---|
| Molecular weight | 261.69 g/mol |
| IUPAC name | (2,3-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | GKURTJIGSLFJOG-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=C(C(=CC=C2)F)F.Cl |
Computed by PubChem (NCBI)