CAS 140235-26-3 appears in our catalog under these names: (3,4-Difluoro-phenyl)-piperidin-4-yl-methanone hydrochloride, 98%, (3,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride, 97%, (3,4-Difluoro-phenyl)-piperidin-4-yl-methanone, HCl, 97%, 97%, (3,4-DIFLUORO-PHENYL)-PIPERIDIN-4-YL-METHANONE HCL, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg, 2.5g.
(3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 140235-26-3) is a chemical compound with the molecular formula C12H14ClF2NO and a molecular weight of 261.69 g/mol. IUPAC name: (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: IPNJNEPAHFKDLB-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO |
|---|---|
| Molecular weight | 261.69 g/mol |
| IUPAC name | (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | IPNJNEPAHFKDLB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)