CAS 1559064-01-5 is the registry number for 1-Methyl-n-(4-pyridinylmethyl)-4-piperidinamine diethanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;oxalic acid (CAS 1559064-01-5) is a chemical compound with the molecular formula C16H23N3O8 and a molecular weight of 385.37 g/mol. IUPAC name: 1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;oxalic acid. InChIKey: WMLGQIWZONRLIG-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O8 |
|---|---|
| Molecular weight | 385.37 g/mol |
| IUPAC name | 1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;oxalic acid |
| InChIKey | WMLGQIWZONRLIG-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)NCC2=CC=NC=C2.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)