Products 1609402-87-0

CAS 1609402-87-0 is the registry number for 1-Methyl-n-(3-pyridinylmethyl)-4-piperidinamine diethanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-methyl-N-(pyridin-3-ylmethyl)piperidin-4-amine;oxalic acid (CAS 1609402-87-0) is a chemical compound with the molecular formula C16H23N3O8 and a molecular weight of 385.37 g/mol. IUPAC name: 1-methyl-N-(pyridin-3-ylmethyl)piperidin-4-amine;oxalic acid. InChIKey: KLNAJZGJTGAFMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23N3O8
Molecular weight385.37 g/mol
IUPAC name1-methyl-N-(pyridin-3-ylmethyl)piperidin-4-amine;oxalic acid
InChIKeyKLNAJZGJTGAFMQ-UHFFFAOYSA-N
SMILESCN1CCC(CC1)NCC2=CN=CC=C2.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)