Products 1559064-14-0

CAS 1559064-14-0 is the registry number for 1-(Difluoromethyl)-5-methyl-1h-pyrrole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(difluoromethyl)-5-methylpyrrole-2-carboxylic acid (CAS 1559064-14-0) is a chemical compound with the molecular formula C7H7F2NO2 and a molecular weight of 175.13 g/mol. IUPAC name: 1-(difluoromethyl)-5-methylpyrrole-2-carboxylic acid. InChIKey: QZXIKIOBIKQPGD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F2NO2
Molecular weight175.13 g/mol
IUPAC name1-(difluoromethyl)-5-methylpyrrole-2-carboxylic acid
InChIKeyQZXIKIOBIKQPGD-UHFFFAOYSA-N
SMILESCC1=CC=C(N1C(F)F)C(=O)O

Computed by PubChem (NCBI)