CAS 2093928-28-8 is the registry number for OV329. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-amino-4-(difluoromethylidene)cyclopentene-1-carboxylic acid (CAS 2093928-28-8) is a chemical compound with the molecular formula C7H7F2NO2 and a molecular weight of 175.13 g/mol. IUPAC name: (3S)-3-amino-4-(difluoromethylidene)cyclopentene-1-carboxylic acid. InChIKey: FBLNZOCTNRXJQD-YFKPBYRVSA-N.
| Molecular formula | C7H7F2NO2 |
|---|---|
| Molecular weight | 175.13 g/mol |
| IUPAC name | (3S)-3-amino-4-(difluoromethylidene)cyclopentene-1-carboxylic acid |
| InChIKey | FBLNZOCTNRXJQD-YFKPBYRVSA-N |
| SMILES | C1C(=C[C@@H](C1=C(F)F)N)C(=O)O |
Computed by PubChem (NCBI)