Products 156048-92-9

CAS 156048-92-9 is the registry number for Pregabalin Impurity 189. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3R)-3-(2-methoxy-2-oxoethyl)-5-methylhexanoic acid (CAS 156048-92-9) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: (3R)-3-(2-methoxy-2-oxoethyl)-5-methylhexanoic acid. InChIKey: NRXIYKWMCOQUTK-MRVPVSSYSA-N.

Identity
Molecular formulaC10H18O4
Molecular weight202.25 g/mol
IUPAC name(3R)-3-(2-methoxy-2-oxoethyl)-5-methylhexanoic acid
InChIKeyNRXIYKWMCOQUTK-MRVPVSSYSA-N
SMILESCC(C)C[C@H](CC(=O)O)CC(=O)OC

Computed by PubChem (NCBI)