CAS 1560647-93-9 appears in our catalog under these names: 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-ol, 95%, 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)indan-4-ol, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-ol (CAS 1560647-93-9) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-ol. InChIKey: XTZGEJAPLJCXCG-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-ol |
| InChIKey | XTZGEJAPLJCXCG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCC3=C(C=C2)O |
Computed by PubChem (NCBI)