Products 1562123-84-5
CAS 1562123-84-5 is the registry number for Meropenem Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (4R)-2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate (CAS 1562123-84-5) is a chemical compound with the molecular formula C11H15N3O5 and a molecular weight of 269.25 g/mol. IUPAC name: methyl (4R)-2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate. InChIKey: GAMXDBKLKWZRGS-DBRKOABJSA-N.
| Molecular formula | C11H15N3O5 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | methyl (4R)-2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| InChIKey | GAMXDBKLKWZRGS-DBRKOABJSA-N |
| SMILES | C[C@H]([C@@H]1[C@H](NC1=O)[C@@H](C)C(=O)C(=[N+]=[N-])C(=O)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Meropenem Impurity 24