Products 77658-97-0
CAS 77658-97-0 appears in our catalog under these names: Triglycidylurazole, Anaxirone. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, Get quote.
1,2,4-tris(oxiran-2-ylmethyl)-1,2,4-triazolidine-3,5-dione (CAS 77658-97-0) is a chemical compound with the molecular formula C11H15N3O5 and a molecular weight of 269.25 g/mol. IUPAC name: 1,2,4-tris(oxiran-2-ylmethyl)-1,2,4-triazolidine-3,5-dione. InChIKey: ZTXDHEQQZVFGPK-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O5 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 1,2,4-tris(oxiran-2-ylmethyl)-1,2,4-triazolidine-3,5-dione |
| InChIKey | ZTXDHEQQZVFGPK-UHFFFAOYSA-N |
| SMILES | C1C(O1)CN2C(=O)N(N(C2=O)CC3CO3)CC4CO4 |
Computed by PubChem (NCBI)