Products 156213-02-4

CAS 156213-02-4 is the registry number for 3-(5-Chloro-1-methyl-1h-benzo[d]imidazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(5-chloro-1-methylbenzimidazol-2-yl)propanoic acid (CAS 156213-02-4) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 3-(5-chloro-1-methylbenzimidazol-2-yl)propanoic acid. InChIKey: DCKIVTPNGMSVGF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClN2O2
Molecular weight238.67 g/mol
IUPAC name3-(5-chloro-1-methylbenzimidazol-2-yl)propanoic acid
InChIKeyDCKIVTPNGMSVGF-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)Cl)N=C1CCC(=O)O

Computed by PubChem (NCBI)