CAS 156213-02-4 is the registry number for 3-(5-Chloro-1-methyl-1h-benzo[d]imidazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
3-(5-chloro-1-methylbenzimidazol-2-yl)propanoic acid (CAS 156213-02-4) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 3-(5-chloro-1-methylbenzimidazol-2-yl)propanoic acid. InChIKey: DCKIVTPNGMSVGF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 3-(5-chloro-1-methylbenzimidazol-2-yl)propanoic acid |
| InChIKey | DCKIVTPNGMSVGF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)N=C1CCC(=O)O |
Computed by PubChem (NCBI)