CAS 156213-03-5 appears in our catalog under these names: 3-(6-Chloro-1-methyl-1H-benzimidazol-2-yl)propanoic acid, 95%, 3-(6-Chloro-1-methyl-1H-benzimidazol-2-yl)propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 1000mg, 500mg, 2000mg, 5000mg.
3-(6-chloro-1-methylbenzimidazol-2-yl)propanoic acid (CAS 156213-03-5) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 3-(6-chloro-1-methylbenzimidazol-2-yl)propanoic acid. InChIKey: XPWJLVHVDASFMS-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 3-(6-chloro-1-methylbenzimidazol-2-yl)propanoic acid |
| InChIKey | XPWJLVHVDASFMS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Cl)N=C1CCC(=O)O |
Computed by PubChem (NCBI)