Products 1562180-31-7
CAS 1562180-31-7 is the registry number for N4-(4-Fluorophenyl)-7-methoxyquinazoline-4,6-diamine (Dacomitinib Impurity), 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg.
4-N-(4-fluorophenyl)-7-methoxyquinazoline-4,6-diamine (CAS 1562180-31-7) is a chemical compound with the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. IUPAC name: 4-N-(4-fluorophenyl)-7-methoxyquinazoline-4,6-diamine. InChIKey: WJMYLQRNFZYXIT-UHFFFAOYSA-N.
| Molecular formula | C15H13FN4O |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 4-N-(4-fluorophenyl)-7-methoxyquinazoline-4,6-diamine |
| InChIKey | WJMYLQRNFZYXIT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)