CAS 156232-25-6 appears in our catalog under these names: 5-Isopropylindolin-2-one, 95%, 5-Isopropylindolin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
5-propan-2-yl-1,3-dihydroindol-2-one (CAS 156232-25-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 5-propan-2-yl-1,3-dihydroindol-2-one. InChIKey: RVQDZCMDQOGRCG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 5-propan-2-yl-1,3-dihydroindol-2-one |
| InChIKey | RVQDZCMDQOGRCG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)NC(=O)C2 |
Computed by PubChem (NCBI)