CAS 1562434-91-6 is the registry number for Avanafil Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid (CAS 1562434-91-6) is a chemical compound with the molecular formula C14H14ClN3O4S and a molecular weight of 355.8 g/mol. IUPAC name: 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid. InChIKey: HRIQKWQGCKFNFA-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O4S |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid |
| InChIKey | HRIQKWQGCKFNFA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC2=NC(=NC=C2C(=O)O)S(=O)C)Cl |
Computed by PubChem (NCBI)