CAS 188915-46-0 is the registry number for Cefaclor Impurity 78. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2R,3R)-3-[[(2R)-2-amino-2-phenylacetyl]amino]-4-oxoazetidin-2-yl]sulfanyl-2-chloroprop-2-enoic acid (CAS 188915-46-0) is a chemical compound with the molecular formula C14H14ClN3O4S and a molecular weight of 355.8 g/mol. IUPAC name: 3-[(2R,3R)-3-[[(2R)-2-amino-2-phenylacetyl]amino]-4-oxoazetidin-2-yl]sulfanyl-2-chloroprop-2-enoic acid. InChIKey: SRLWLJAQVFKSSK-GIPNMCIBSA-N.
| Molecular formula | C14H14ClN3O4S |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 3-[(2R,3R)-3-[[(2R)-2-amino-2-phenylacetyl]amino]-4-oxoazetidin-2-yl]sulfanyl-2-chloroprop-2-enoic acid |
| InChIKey | SRLWLJAQVFKSSK-GIPNMCIBSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)N[C@H]2[C@H](NC2=O)SC=C(C(=O)O)Cl)N |
Computed by PubChem (NCBI)