CAS 1563006-28-9 appears in our catalog under these names: (S)-1-(2-Hydroxyacetyl)pyrrolidine-2-carbonitrile, 97%, Vildagliptin Impurity 25, Vildagliptin Impurity 43, Vildagliptin Impurity 42. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-1-(2-hydroxyacetyl)pyrrolidine-2-carbonitrile (CAS 1563006-28-9) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: (2S)-1-(2-hydroxyacetyl)pyrrolidine-2-carbonitrile. InChIKey: HOAXAMIXIJSFGP-LURJTMIESA-N.
| Molecular formula | C7H10N2O2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | (2S)-1-(2-hydroxyacetyl)pyrrolidine-2-carbonitrile |
| InChIKey | HOAXAMIXIJSFGP-LURJTMIESA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CO)C#N |
Computed by PubChem (NCBI)