Products 172875-52-4

CAS 172875-52-4 is the registry number for 2-Propyl-1h-imidazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-propyl-1H-imidazole-5-carboxylic acid (CAS 172875-52-4) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: 2-propyl-1H-imidazole-5-carboxylic acid. InChIKey: BSHYBKDYLYQPNC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O2
Molecular weight154.17 g/mol
IUPAC name2-propyl-1H-imidazole-5-carboxylic acid
InChIKeyBSHYBKDYLYQPNC-UHFFFAOYSA-N
SMILESCCCC1=NC=C(N1)C(=O)O

Computed by PubChem (NCBI)