CAS 1563530-72-2 is the registry number for 2-(5-Bromopyrimidin-2-yl)thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-bromopyrimidin-2-yl)-1,3-thiazole (CAS 1563530-72-2) is a chemical compound with the molecular formula C7H4BrN3S and a molecular weight of 242.10 g/mol. IUPAC name: 2-(5-bromopyrimidin-2-yl)-1,3-thiazole. InChIKey: FJDSQTCXENIJHJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3S |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-(5-bromopyrimidin-2-yl)-1,3-thiazole |
| InChIKey | FJDSQTCXENIJHJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)