CAS 412923-47-8 is the registry number for 3-(5-Bromo-1,3,4-thiadiazol-2-yl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-5-pyridin-3-yl-1,3,4-thiadiazole (CAS 412923-47-8) is a chemical compound with the molecular formula C7H4BrN3S and a molecular weight of 242.10 g/mol. IUPAC name: 2-bromo-5-pyridin-3-yl-1,3,4-thiadiazole. InChIKey: LEJKMPAVMFZPNR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3S |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-bromo-5-pyridin-3-yl-1,3,4-thiadiazole |
| InChIKey | LEJKMPAVMFZPNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN=C(S2)Br |
Computed by PubChem (NCBI)