CAS 156365-16-1 appears in our catalog under these names: 6-Benzyl-2-oxo-1,2,5,6,7,8-hexahydro-1,6-naphthyridine-3-carbonitrile, 95%, 6-Benzyl-2-oxo-1,2,5,6,7,8-hexahydro-1,6-naphthyridine-3-carbonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
6-benzyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile (CAS 156365-16-1) is a chemical compound with the molecular formula C16H15N3O and a molecular weight of 265.31 g/mol. IUPAC name: 6-benzyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile. InChIKey: QYRRQLGZTVTRME-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 6-benzyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
| InChIKey | QYRRQLGZTVTRME-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1NC(=O)C(=C2)C#N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)