CAS 76674-04-9 is the registry number for 1,1-Diphenyl-2-(1h-1,2,4-triazol-1-yl)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,1-diphenyl-2-(1,2,4-triazol-1-yl)ethanol (CAS 76674-04-9) is a chemical compound with the molecular formula C16H15N3O and a molecular weight of 265.31 g/mol. IUPAC name: 1,1-diphenyl-2-(1,2,4-triazol-1-yl)ethanol. InChIKey: JNVGRNNYXIUXCH-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 1,1-diphenyl-2-(1,2,4-triazol-1-yl)ethanol |
| InChIKey | JNVGRNNYXIUXCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN2C=NC=N2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)