CAS 15641-49-3 appears in our catalog under these names: 2–Amino–3–(5–iodo–1H–indol–3–yl)propanoic acid, 2-Amino-3-(5-iodo-1h-indol-3-yl)propanoic acid, 95%, 2-Amino-3-(5-iodo-1H-indol-3-yl)propanoic acid, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-amino-3-(5-iodo-1H-indol-3-yl)propanoic acid (CAS 15641-49-3) is a chemical compound with the molecular formula C11H11IN2O2 and a molecular weight of 330.12 g/mol. IUPAC name: 2-amino-3-(5-iodo-1H-indol-3-yl)propanoic acid. InChIKey: KZMSFQVSICYJHE-UHFFFAOYSA-N.
| Molecular formula | C11H11IN2O2 |
|---|---|
| Molecular weight | 330.12 g/mol |
| IUPAC name | 2-amino-3-(5-iodo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZMSFQVSICYJHE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)