CAS 1698778-47-0 is the registry number for 1-(5-Iodo-2-methylphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-iodo-2-methylphenyl)-1,3-diazinane-2,4-dione (CAS 1698778-47-0) is a chemical compound with the molecular formula C11H11IN2O2 and a molecular weight of 330.12 g/mol. IUPAC name: 1-(5-iodo-2-methylphenyl)-1,3-diazinane-2,4-dione. InChIKey: BWWDRAGWYJFCPC-UHFFFAOYSA-N.
| Molecular formula | C11H11IN2O2 |
|---|---|
| Molecular weight | 330.12 g/mol |
| IUPAC name | 1-(5-iodo-2-methylphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | BWWDRAGWYJFCPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)N2CCC(=O)NC2=O |
Computed by PubChem (NCBI)