CAS 1564515-67-8 appears in our catalog under these names: 3-Chloro-5-(3,5-dichlorophenyl)-1,2,4-oxadiazole, 95%, 3-Chloro-5-(3,5-dichlorophenyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chloro-5-(3,5-dichlorophenyl)-1,2,4-oxadiazole (CAS 1564515-67-8) is a chemical compound with the molecular formula C8H3Cl3N2O and a molecular weight of 249.5 g/mol. IUPAC name: 3-chloro-5-(3,5-dichlorophenyl)-1,2,4-oxadiazole. InChIKey: CKGXPHLXWKGJKA-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2O |
|---|---|
| Molecular weight | 249.5 g/mol |
| IUPAC name | 3-chloro-5-(3,5-dichlorophenyl)-1,2,4-oxadiazole |
| InChIKey | CKGXPHLXWKGJKA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NC(=NO2)Cl |
Computed by PubChem (NCBI)