CAS 2763156-08-5 is the registry number for 3,5,7-Trichloro-1,6-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,7-trichloro-1H-1,6-naphthyridin-2-one (CAS 2763156-08-5) is a chemical compound with the molecular formula C8H3Cl3N2O and a molecular weight of 249.5 g/mol. IUPAC name: 3,5,7-trichloro-1H-1,6-naphthyridin-2-one. InChIKey: LNMFUDPDIOMVTC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2O |
|---|---|
| Molecular weight | 249.5 g/mol |
| IUPAC name | 3,5,7-trichloro-1H-1,6-naphthyridin-2-one |
| InChIKey | LNMFUDPDIOMVTC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)Cl)C=C(C(=O)N2)Cl |
Computed by PubChem (NCBI)