CAS 1564662-51-6 appears in our catalog under these names: 3-Amino-2-(2,2-difluoroethoxy)benzamide, 95%, 3-Amino-2-(2,2-difluoroethoxy)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-amino-2-(2,2-difluoroethoxy)benzamide (CAS 1564662-51-6) is a chemical compound with the molecular formula C9H10F2N2O2 and a molecular weight of 216.18 g/mol. IUPAC name: 3-amino-2-(2,2-difluoroethoxy)benzamide. InChIKey: WVIPRUDHZZUGND-UHFFFAOYSA-N.
| Molecular formula | C9H10F2N2O2 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 3-amino-2-(2,2-difluoroethoxy)benzamide |
| InChIKey | WVIPRUDHZZUGND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)OCC(F)F)C(=O)N |
Computed by PubChem (NCBI)