Products 1564713-64-9
CAS 1564713-64-9 appears in our catalog under these names: 3-Fluoro-2-(2,2,2-trifluoroethoxy)benzaldehyde, 95%, 3-Fluoro-2-(2,2,2-trifluoroethoxy)benzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-fluoro-2-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 1564713-64-9) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 3-fluoro-2-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: HOZSGAKRDRTJAB-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 3-fluoro-2-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | HOZSGAKRDRTJAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OCC(F)(F)F)C=O |
Computed by PubChem (NCBI)