CAS 1564917-02-7 appears in our catalog under these names: 5-bromo-8-fluoro-3,4-dihydroquinazolin-4-one, 95%, 5-Bromo-8-fluoro-3,4-dihydroquinazolin-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
5-bromo-8-fluoro-3H-quinazolin-4-one (CAS 1564917-02-7) is a chemical compound with the molecular formula C8H4BrFN2O and a molecular weight of 243.03 g/mol. IUPAC name: 5-bromo-8-fluoro-3H-quinazolin-4-one. InChIKey: KJKYJJRBYPEFPB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O |
|---|---|
| Molecular weight | 243.03 g/mol |
| IUPAC name | 5-bromo-8-fluoro-3H-quinazolin-4-one |
| InChIKey | KJKYJJRBYPEFPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)N=CNC2=O)Br |
Computed by PubChem (NCBI)