CAS 2419129-88-5 is the registry number for 8-Bromo-7-fluoro-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-7-fluoro-1H-1,5-naphthyridin-2-one (CAS 2419129-88-5) is a chemical compound with the molecular formula C8H4BrFN2O and a molecular weight of 243.03 g/mol. IUPAC name: 8-bromo-7-fluoro-1H-1,5-naphthyridin-2-one. InChIKey: DSXQYZQLJVBXIB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O |
|---|---|
| Molecular weight | 243.03 g/mol |
| IUPAC name | 8-bromo-7-fluoro-1H-1,5-naphthyridin-2-one |
| InChIKey | DSXQYZQLJVBXIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C(=CN=C21)F)Br |
Computed by PubChem (NCBI)