Products 1564924-85-1
CAS 1564924-85-1 appears in our catalog under these names: 3-Bromoquinoline-2-carboxylic acid, 3-Bromoquinoline-2-carboxylic acid, 95%, 95%, 3-BROMOQUINOLINE-2-CARBOXYLIC ACID, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
3-bromoquinoline-2-carboxylic acid (CAS 1564924-85-1) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 3-bromoquinoline-2-carboxylic acid. InChIKey: CWLWJWAETQLUHB-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 3-bromoquinoline-2-carboxylic acid |
| InChIKey | CWLWJWAETQLUHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)C(=O)O)Br |
Computed by PubChem (NCBI)