CAS 1565044-46-3 appears in our catalog under these names: 1-(2-(2-Chloroacetyl)pyrrolidin-1-yl)-2,2,2-trifluoroethan-1-one, 95%, 1-(2-(2-Chloroacetyl)pyrrolidin-1-yl)-2,2,2-trifluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-[2-(2-chloroacetyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone (CAS 1565044-46-3) is a chemical compound with the molecular formula C8H9ClF3NO2 and a molecular weight of 243.61 g/mol. IUPAC name: 1-[2-(2-chloroacetyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone. InChIKey: WXOONYPBXSUAAV-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO2 |
|---|---|
| Molecular weight | 243.61 g/mol |
| IUPAC name | 1-[2-(2-chloroacetyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| InChIKey | WXOONYPBXSUAAV-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C(F)(F)F)C(=O)CCl |
Computed by PubChem (NCBI)