Products 647855-19-4

CAS 647855-19-4 is the registry number for 4-METHOXY-3-(TRIFLUOROMETHOXY)ANILINE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

4-methoxy-3-(trifluoromethoxy)aniline;hydrochloride (CAS 647855-19-4) is a chemical compound with the molecular formula C8H9ClF3NO2 and a molecular weight of 243.61 g/mol. IUPAC name: 4-methoxy-3-(trifluoromethoxy)aniline;hydrochloride. InChIKey: RFVFKEQYLSCYGF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClF3NO2
Molecular weight243.61 g/mol
IUPAC name4-methoxy-3-(trifluoromethoxy)aniline;hydrochloride
InChIKeyRFVFKEQYLSCYGF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)N)OC(F)(F)F.Cl

Computed by PubChem (NCBI)