CAS 156526-48-6 is the registry number for (1alpha,3alpha,5alpha)-3,5-dihydroxy-cyclohexanecarboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 5g.
Cis-methyl (3R,5S)-3,5-dihydroxycyclohexane-1-carboxylate (CAS 156526-48-6) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: cis-methyl (3R,5S)-3,5-dihydroxycyclohexane-1-carboxylate. InChIKey: JKJAVWYVQRYVFS-DGUCWDHESA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | cis-methyl (3R,5S)-3,5-dihydroxycyclohexane-1-carboxylate |
| InChIKey | JKJAVWYVQRYVFS-DGUCWDHESA-N |
| SMILES | COC(=O)C1C[C@@H](C[C@@H](C1)O)O |
Computed by PubChem (NCBI)