Products 1566-07-0

CAS 1566-07-0 is the registry number for 7-(4-Chlorophenyl)-4,7-dioxoheptanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

7-(4-chlorophenyl)-4,7-dioxoheptanoic acid (CAS 1566-07-0) is a chemical compound with the molecular formula C13H13ClO4 and a molecular weight of 268.69 g/mol. IUPAC name: 7-(4-chlorophenyl)-4,7-dioxoheptanoic acid. InChIKey: CKVYUNHHSGWDMH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13ClO4
Molecular weight268.69 g/mol
IUPAC name7-(4-chlorophenyl)-4,7-dioxoheptanoic acid
InChIKeyCKVYUNHHSGWDMH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)CCC(=O)CCC(=O)O)Cl

Computed by PubChem (NCBI)