CAS 1566-07-0 is the registry number for 7-(4-Chlorophenyl)-4,7-dioxoheptanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7-(4-chlorophenyl)-4,7-dioxoheptanoic acid (CAS 1566-07-0) is a chemical compound with the molecular formula C13H13ClO4 and a molecular weight of 268.69 g/mol. IUPAC name: 7-(4-chlorophenyl)-4,7-dioxoheptanoic acid. InChIKey: CKVYUNHHSGWDMH-UHFFFAOYSA-N.
| Molecular formula | C13H13ClO4 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 7-(4-chlorophenyl)-4,7-dioxoheptanoic acid |
| InChIKey | CKVYUNHHSGWDMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)