CAS 88466-67-5 is the registry number for 5-(4-Chlorobenzyl)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 88466-67-5) is a chemical compound with the molecular formula C13H13ClO4 and a molecular weight of 268.69 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: DBPJFECUSKQONM-UHFFFAOYSA-N.
| Molecular formula | C13H13ClO4 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | DBPJFECUSKQONM-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)CC2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)