CAS 1566199-66-3 appears in our catalog under these names: 4,6-Dichloro-8-fluoroquinazoline, 95%, 4,6-Dichloro-8-fluoroquinazoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,6-dichloro-8-fluoroquinazoline (CAS 1566199-66-3) is a chemical compound with the molecular formula C8H3Cl2FN2 and a molecular weight of 217.02 g/mol. IUPAC name: 4,6-dichloro-8-fluoroquinazoline. InChIKey: BVBYNWPRFHMXTC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2FN2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 4,6-dichloro-8-fluoroquinazoline |
| InChIKey | BVBYNWPRFHMXTC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC=N2)Cl)F)Cl |
Computed by PubChem (NCBI)